CymitQuimica logo

CAS 77377-07-2

:

4-[(E)-2-(pyridin-2-yl)ethenyl]phenol

Description:
4-[(E)-2-(pyridin-2-yl)ethenyl]phenol, with the CAS number 77377-07-2, is an organic compound characterized by its phenolic structure and a pyridine moiety. This compound features a phenol group substituted with an ethenyl group that is further substituted with a pyridine ring, indicating its potential for various chemical interactions. It typically exhibits properties associated with phenolic compounds, such as being a weak acid due to the hydroxyl (-OH) group, and may participate in hydrogen bonding. The presence of the pyridine ring can enhance its solubility in polar solvents and may influence its reactivity, making it useful in various chemical applications, including as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the compound may exhibit biological activity, which is common among phenolic derivatives, potentially leading to applications in pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c15-13-8-5-11(6-9-13)4-7-12-3-1-2-10-14-12/h1-10,15H/b7-4+
Synonyms:
  • 4-[(E)-2-(Pyridin-2-yl)vinyl]phenol
  • phenol, 4-[(E)-2-(2-pyridinyl)ethenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.