CAS 77378-05-3
:N-[9-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]purin-6-yl]octanamide
Description:
N-[9-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]purin-6-yl]octanamide, with the CAS number 77378-05-3, is a chemical compound that features a complex structure combining a purine base with a tetrahydrofuran moiety. This compound is characterized by its specific stereochemistry, indicated by the (2R,5S) configuration, which plays a crucial role in its biological activity. The presence of hydroxyl groups contributes to its hydrophilicity, potentially influencing its solubility and interaction with biological systems. The octanamide side chain may enhance lipophilicity, affecting membrane permeability and cellular uptake. This compound is of interest in medicinal chemistry, particularly in the development of nucleoside analogs or other therapeutic agents. Its unique structural features suggest potential applications in biochemistry and pharmacology, especially in targeting specific biological pathways or mechanisms. As with many compounds of this nature, understanding its reactivity, stability, and interaction with biological targets is essential for evaluating its potential uses in research and medicine.
Formula:C18H27N5O4
InChI:InChI=1/C18H27N5O4/c1-2-3-4-5-6-7-14(26)22-16-15-17(20-10-19-16)23(11-21-15)18-13(25)8-12(9-24)27-18/h10-13,18,24-25H,2-9H2,1H3,(H,19,20,22,26)/t12-,13?,18+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N6-Octanoyl Cordycepin
CAS:Controlled ProductFormula:C17H27N3O5Color and Shape:NeatMolecular weight:353.4133'-Deoxy-N6-octanoyladenosine
CAS:3'-Deoxy-N6-octanoyladenosine is a nucleoside that is used to synthesize DNA, RNA, and other nucleic acid molecules. It has antiviral and anticancer properties. 3'-Deoxy-N6-octanoyladenosine has been shown to be an activator of phosphoramidites in the synthesis of DNA. This compound also inhibits the growth of cancer cells by inhibiting the synthesis of DNA and RNA in cells. The purity of this product is >98% and it can be used for research purposes or as a pharmaceutical intermediate.Formula:C18H27N5O4Purity:Min. 95%Molecular weight:377.44 g/mol



