CAS 77382-78-6

3-hydroxy-4-[methyl(nitroso)amino]butanoic acid

Description:

3-Hydroxy-4-[methyl(nitroso)amino]butanoic acid, with the CAS number 77382-78-6, is a chemical compound that features a butanoic acid backbone modified with a hydroxyl group and a nitroso-substituted methylamino group. This compound is characterized by its functional groups, which include a carboxylic acid, a hydroxyl group, and a nitroso group attached to a methylamino moiety. The presence of these groups suggests potential reactivity, particularly in biological systems, where it may participate in various biochemical pathways. The compound's structure indicates it may exhibit polar characteristics due to the hydroxyl and carboxylic acid groups, which can influence its solubility in water and interaction with other molecules. Additionally, the nitroso group may impart unique properties, potentially affecting its stability and reactivity. Overall, 3-hydroxy-4-[methyl(nitroso)amino]butanoic acid is of interest in chemical and biological research, particularly in the study of amino acids and their derivatives.

Formula: C₅H₁₀N₂O₄

InChI: InChI=1/C5H10N2O4/c1-7(6-11)3-4(8)2-5(9)10/h4,8H,2-3H2,1H3,(H,9,10)

SMILES: CN(CC(CC(=O)O)O)N=O

3-Hydroxy-4-[methyl(nitros)amino]butanoic Acid

Controlled Product

CAS: 77382-78-6

Formula: C₅H₁₀N₂O₄

Color and Shape: Neat

Molecular weight: 162.144

Ref: TR-N773820