CAS 773838-08-7
:N-(4-hydroxybenzoyl)-beta-alanine
Description:
N-(4-hydroxybenzoyl)-beta-alanine, also known by its CAS number 773838-08-7, is an organic compound characterized by the presence of a beta-alanine moiety linked to a 4-hydroxybenzoyl group. This compound features a carboxylic acid functional group, an amine group, and a hydroxyl group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid, soluble in polar solvents due to its hydrophilic functional groups. The presence of the hydroxyl group enhances its reactivity and potential for hydrogen bonding, which can influence its solubility and interaction with biological systems. N-(4-hydroxybenzoyl)-beta-alanine may exhibit antioxidant properties and could be of interest in pharmaceutical and cosmetic applications. Its structural characteristics suggest potential roles in drug formulation or as a biochemical probe, although specific biological activities and applications would require further investigation. As with many organic compounds, proper handling and safety measures should be observed due to potential reactivity and toxicity.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c12-8-3-1-7(2-4-8)10(15)11-6-5-9(13)14/h1-4,12H,5-6H2,(H,11,15)(H,13,14)
SMILES:c1cc(ccc1C(=O)NCCC(=O)O)O
Synonyms:- 3-[(4-Hydroxybenzoyl)Amino]Propanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(4-Hydroxybenzoyl)-β-alanine
CAS:Controlled ProductFormula:C10H11NO4Color and Shape:NeatMolecular weight:209.199

