
CAS 773841-56-8
:3-Amino-4-(dimethylamino)-1-butanol
Description:
3-Amino-4-(dimethylamino)-1-butanol, with the CAS number 773841-56-8, is an organic compound characterized by the presence of both amino and alcohol functional groups. This substance typically appears as a colorless to pale yellow liquid and is soluble in water due to its polar functional groups. The compound features a butanol backbone, which contributes to its hydrophilicity, while the dimethylamino group enhances its basicity and potential for forming salts. It is often used in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the amino group allows for potential reactivity in nucleophilic substitution reactions, while the alcohol group can participate in hydrogen bonding, influencing its physical properties. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, 3-Amino-4-(dimethylamino)-1-butanol is a versatile compound with significant utility in organic synthesis and industrial applications.
Formula:C6H16N2O
InChI:InChI=1S/C6H16N2O/c1-8(2)5-6(7)3-4-9/h6,9H,3-5,7H2,1-2H3
InChI key:InChIKey=QFWDFUAVEWJERX-UHFFFAOYSA-N
SMILES:C(C(CCO)N)N(C)C
Synonyms:- 3-Amino-4-(dimethylamino)-1-butanol
- 1-Butanol, 3-amino-4-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.