
CAS 773868-62-5
:5-Bromo-2-(difluoromethoxy)benzenemethanol
Description:
5-Bromo-2-(difluoromethoxy)benzenemethanol is an organic compound characterized by its unique molecular structure, which includes a bromine atom and a difluoromethoxy group attached to a benzene ring. The presence of the bromine substituent enhances its reactivity, making it a useful intermediate in various chemical syntheses. The difluoromethoxy group contributes to its polar nature, potentially influencing its solubility in different solvents and its interactions with biological systems. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its hydroxyl (-OH) group indicates that it can participate in hydrogen bonding, which can affect its physical properties such as boiling point and melting point. Additionally, the compound's structure suggests potential applications in agrochemicals or pharmaceuticals, where halogenated compounds often play a significant role. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens and the potential for toxicity.
Formula:C8H7BrF2O2
InChI:InChI=1S/C8H7BrF2O2/c9-6-1-2-7(13-8(10)11)5(3-6)4-12/h1-3,8,12H,4H2
InChI key:InChIKey=VFZRZSHYLSXVDN-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(CO)C=C(Br)C=C1
Synonyms:- 5-Bromo-2-(difluoromethoxy)benzenemethanol
- [5-Bromo-2-(difluoromethoxy)phenyl]methanol
- Benzenemethanol, 5-bromo-2-(difluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.