CAS 773869-57-1
:3-Hydroxy-4-iodobenzenemethanol
Description:
3-Hydroxy-4-iodobenzenemethanol, with the CAS number 773869-57-1, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) and an iodine atom attached to a benzene ring. This compound features a methanol group (-CH2OH) that is directly linked to the aromatic system, contributing to its reactivity and potential applications in organic synthesis. The presence of the iodine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydroxyl group provides hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 3-Hydroxy-4-iodobenzenemethanol is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C7H7IO2
InChI:InChI=1S/C7H7IO2/c8-6-2-1-5(4-9)3-7(6)10/h1-3,9-10H,4H2
InChI key:InChIKey=VIWWSAGABDIIFF-UHFFFAOYSA-N
SMILES:C(O)C1=CC(O)=C(I)C=C1
Synonyms:- 3-Hydroxy-4-iodobenzenemethanol
- 3-Hydroxy-4-iodobenzyl alcohol
- 5-(Hydroxymethyl)-2-Iodophenol
- Benzenemethanol, 3-hydroxy-4-iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(Hydroxymethyl)-2-iodophenol
CAS:Formula:C7H7IO2Purity:98%Color and Shape:SolidMolecular weight:250.03375-(Hydroxymethyl)-2-iodophenol
CAS:5-(Hydroxymethyl)-2-iodophenolFormula:C7H7IO2Purity:97%Color and Shape: faint brown/beige crystalline powderMolecular weight:250.03g/mol3-Hydroxy-4-iodobenzyl alcohol
CAS:<p>3-Hydroxy-4-iodobenzyl alcohol is a nucleophile that can be used as an affinity label for proteins and nucleic acids. 3-Hydoxy-4-iodobenzyl alcohol is capable of disrupting the linker between two molecules, which allows for analysis of protein/nucleic acid interactions. 3-Hydroxy-4-iodobenzyl alcohol can be used to label molecules, but it is not covalently bound to them. It has been shown to show tumor growth inhibition in glioma cells, which may be due to its ability to disrupt factor 1, a transcription factor that regulates cell proliferation and differentiation.</p>Formula:C7H7IO2Purity:Min. 95%Color and Shape:PowderMolecular weight:250.03 g/mol5-(Hydroxymethyl)-2-iodophenol
CAS:Formula:C7H7IO2Purity:97%Color and Shape:SolidMolecular weight:250.035



