CAS 773870-18-1

2-(4-Fluorophenyl)-1H-indole-3-carboxylic acid

Description:

2-(4-Fluorophenyl)-1H-indole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxylic acid functional group (-COOH) at the 3-position of the indole ring contributes to its acidic properties and potential reactivity in various chemical reactions. The 4-fluorophenyl substituent at the 2-position enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically used in research settings, particularly in studies related to pharmacology and drug development, due to its potential interactions with biological targets. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. Additionally, the presence of the fluorine atom can affect the compound's electronic characteristics, potentially impacting its reactivity and interactions with other molecules. Overall, 2-(4-Fluorophenyl)-1H-indole-3-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.

Formula: C₁₅H₁₀FNO₂

InChI: InChI=1S/C15H10FNO2/c16-10-7-5-9(6-8-10)14-13(15(18)19)11-3-1-2-4-12(11)17-14/h1-8,17H,(H,18,19)

InChI key: InChIKey=BQHAIIFRVZNKAW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(NC=2C1=CC=CC2)C3=CC=C(F)C=C3

Synonyms:

• 2-(4-Fluorophenyl)-1H-indole-3-carboxylic acid
• 1H-Indole-3-carboxylic acid, 2-(4-fluorophenyl)-