CAS 773872-99-4

2-(3-Thienyl)benzenemethanol

Description:

2-(3-Thienyl)benzenemethanol, identified by its CAS number 773872-99-4, is an organic compound characterized by the presence of both a thienyl group and a benzyl alcohol moiety. The thienyl group, derived from thiophene, contributes to the compound's aromaticity and potential for various chemical interactions. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic systems. The hydroxyl (-OH) group in the benzyl alcohol structure imparts polar characteristics, allowing for hydrogen bonding, which can influence its reactivity and solubility in different environments. 2-(3-Thienyl)benzenemethanol may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its unique structure allows for potential applications in organic synthesis, pharmaceuticals, and as a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₁₁H₁₀OS

InChI: InChI=1S/C11H10OS/c12-7-9-3-1-2-4-11(9)10-5-6-13-8-10/h1-6,8,12H,7H2

InChI key: InChIKey=UYTQLBWGFXSYGP-UHFFFAOYSA-N

SMILES: C(O)C1=C(C=CC=C1)C=2C=CSC2

Synonyms:

• 2-(3-Thienyl)benzenemethanol
• [2-(3-Thienyl)phenyl]methanol
• [2-(Thiophen-3-yl)phenyl]methanol
• Benzenemethanol, 2-(3-thienyl)-