CAS 773873-24-8
:1-(2-Cyanoethyl)-1H-pyrrole-2-carboxylic acid
Description:
1-(2-Cyanoethyl)-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a cyanoethyl group, which contributes to its reactivity and potential applications in organic synthesis. The carboxylic acid functional group enhances its polarity and solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. The presence of both the cyano and carboxylic acid groups suggests that it may participate in nucleophilic addition reactions, and its unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(2-Cyanoethyl)-1H-pyrrole-2-carboxylic acid is a versatile building block in organic chemistry, with potential applications in drug development and material science.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c9-4-2-6-10-5-1-3-7(10)8(11)12/h1,3,5H,2,6H2,(H,11,12)
InChI key:InChIKey=OTNGGUJKLKAPAU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(CCC#N)C=CC1
Synonyms:- 1H-Pyrrole-2-carboxylicacid,1-(2-cyanoethyl)-(9CI)
- 1H-Pyrrole-2-carboxylic acid, 1-(2-cyanoethyl)-
- 1-(2-Cyanoethyl)-1H-pyrrole-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.