CAS 773873-27-1

4-Bromo-2-(methylsulfonyl)benzenemethanol

Description:

4-Bromo-2-(methylsulfonyl)benzenemethanol is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methylsulfonyl group attached to a benzene ring. The presence of the hydroxymethyl group (-CH2OH) indicates that it is a phenolic compound, which can exhibit various chemical properties such as hydrogen bonding and reactivity towards electrophiles. The bromine substituent typically enhances the compound's reactivity in nucleophilic substitution reactions, while the methylsulfonyl group can influence solubility and polarity. This compound may be used in synthetic organic chemistry as an intermediate or in the development of pharmaceuticals due to its potential biological activity. Its molecular structure suggests it could participate in various chemical reactions, including oxidation and substitution, making it a versatile building block in organic synthesis. Additionally, the presence of both electron-withdrawing and electron-donating groups can affect its electronic properties, influencing its reactivity and interaction with other chemical species.

Formula: C₈H₉BrO₃S

InChI: InChI=1S/C8H9BrO3S/c1-13(11,12)8-4-7(9)3-2-6(8)5-10/h2-4,10H,5H2,1H3

InChI key: InChIKey=WMMVLULSTWDXKF-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=C(CO)C=CC(Br)=C1

Synonyms:

• (4-Bromo-2-methanesulfonylphenyl)methanol
• Benzenemethanol, 4-bromo-2-(methylsulfonyl)-
• (4-Bromo-2-methansulfonyl-phenyl)-methanol
• (4-Bromo-2-(methylsulfonyl)phenyl)methanol
• 4-Bromo-2-(methylsulfonyl)benzenemethanol

Benzenemethanol, 4-bromo-2-(methylsulfonyl)-

CAS: 773873-27-1

Formula: C₈H₉BrO₃S

Purity: 95%

Molecular weight: 265.1243

Ref: IN-DA005MPZ

[4-bromo-2-(methylsulfonyl)phenyl]methanol

CAS: 773873-27-1

[4-bromo-2-(methylsulfonyl)phenyl]methanol

Purity: ≥95%

Molecular weight: 265.13g/mol

Ref: 54-PC105501