CymitQuimica logo

CAS 773875-92-6

:

Methyl 4′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 4′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethyl group (-CF3) at the para position of one of the phenyl rings significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. The carboxylate functional group (-COOCH3) indicates that it is an ester, which can participate in various chemical reactions, including hydrolysis and transesterification. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group. Additionally, due to the presence of fluorine atoms, it may exhibit unique physical properties such as altered boiling and melting points compared to similar compounds without fluorine. Overall, this compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science.
Formula:C15H11F3O2
InChI:InChI=1S/C15H11F3O2/c1-20-14(19)12-4-2-3-11(9-12)10-5-7-13(8-6-10)15(16,17)18/h2-9H,1H3
InChI key:InChIKey=FROAHOFCAMJFIF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=CC1)C2=CC=C(C(F)(F)F)C=C2
Synonyms:
  • Methyl 4′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylate
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.