CAS 773876-05-4
:methyl 2,3-difluoro-6-methoxy-benzoate
Description:
Methyl 2,3-difluoro-6-methoxy-benzoate is an organic compound characterized by its ester functional group, specifically a benzoate. It features a methoxy group (-OCH3) and two fluorine atoms substituted at the 2 and 3 positions of the aromatic ring, which can influence its chemical reactivity and physical properties. The presence of fluorine typically enhances the compound's lipophilicity and may affect its biological activity. The methoxy group can also contribute to the compound's solubility in organic solvents. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their unique properties. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, methyl 2,3-difluoro-6-methoxy-benzoate exemplifies the diverse chemistry of fluorinated aromatic compounds.
Formula:C9H8F2O3
InChI:InChI=1/C9H8F2O3/c1-13-6-4-3-5(10)8(11)7(6)9(12)14-2/h3-4H,1-2H3
SMILES:COc1ccc(c(c1C(=O)OC)F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3-difluoro-6-methoxybenzoate
CAS:Methyl 2,3-difluoro-6-methoxybenzoatePurity:98%Molecular weight:202.16g/mol2,3-Difluoro-6-methoxybenzoic acid methyl ester
CAS:<p>2,3-Difluoro-6-methoxybenzoic acid methyl ester is a versatile building block that can be used in the production of fine chemicals and research chemicals. It is an intermediate for the synthesis of complex compounds and can be used as a reagent or speciality chemical in research. 2,3-Difluoro-6-methoxybenzoic acid methyl ester is also a useful building block for the synthesis of drugs.</p>Formula:C9H8F2O3Purity:Min. 95%Molecular weight:202.15 g/mol


