CAS 773876-11-2

methyl 3-methyl-5-phenylisoxazole-4-carboxylate

Description:

Methyl 3-methyl-5-phenylisoxazole-4-carboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a methyl group and a phenyl group attached to the isoxazole ring, contributing to its unique properties and reactivity. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 3-methyl-5-phenylisoxazole-4-carboxylate is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its solubility and stability can vary based on the solvent and environmental conditions, making it important to consider these factors in experimental settings. Additionally, the compound's molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced or altered properties. Overall, this compound exemplifies the diverse chemistry associated with isoxazole derivatives.

Formula: C₁₂H₁₁NO₃

InChI: InChI=1/C12H11NO3/c1-8-10(12(14)15-2)11(16-13-8)9-6-4-3-5-7-9/h3-7H,1-2H3

SMILES: Cc1c(c(c2ccccc2)on1)C(=O)OC

Synonyms:

• 3-Methyl-5-phenyl-isoxazole-4-carboxylic acid methyl ester

3-Methyl-5-phenyl-isoxazole-4-carboxylic acid methyl ester

CAS: 773876-11-2

3-Methyl-5-phenyl-isoxazole-4-carboxylic acid methyl ester

Purity: 95%

Molecular weight: 217.224g/mol

Ref: 54-OR97802