CAS 773877-46-6

N-Methyl-N-[(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-6-quinazolinyl)sulfonyl]glycine

Description:

N-Methyl-N-[(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-6-quinazolinyl)sulfonyl]glycine, identified by its CAS number 773877-46-6, is a synthetic compound that belongs to the class of sulfonyl-containing amino acids. This substance features a complex molecular structure characterized by a quinazoline ring, which contributes to its potential biological activity. The presence of the sulfonyl group enhances its solubility and reactivity, making it a candidate for various pharmaceutical applications. The compound is likely to exhibit properties such as moderate to high polarity due to the functional groups present, which may influence its interaction with biological targets. Additionally, the presence of the methyl and dioxo groups suggests potential for specific interactions in biological systems, possibly affecting enzyme activity or receptor binding. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₁₃H₁₅N₃O₆S

InChI: InChI=1S/C13H15N3O6S/c1-14(7-11(17)18)23(21,22)8-4-5-10-9(6-8)12(19)16(3)13(20)15(10)2/h4-6H,7H2,1-3H3,(H,17,18)

InChI key: InChIKey=PNUVYRXYVAFPPG-UHFFFAOYSA-N

SMILES: O=C1C=2C(N(C)C(=O)N1C)=CC=C(S(N(CC(O)=O)C)(=O)=O)C2

Synonyms:

• 2-[(1,3-Dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]acetic acid
• 2-(N-Methyl1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamido)acetic acid
• Glycine, N-methyl-N-[(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-6-quinazolinyl)sulfonyl]-
• N-Methyl-N-[(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-6-quinazolinyl)sulfonyl]glycine
• [[(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-quinazolin-6-yl)sulfonyl](methyl)amino]acetic acid