CymitQuimica logo

CAS 77390-81-9

:

benzyl [(2Z)-2-amino-2-iminoethyl]carbamate

Description:
Benzyl [(2Z)-2-amino-2-iminoethyl]carbamate, identified by its CAS number 77390-81-9, is a chemical compound characterized by its unique structural features. It contains a benzyl group, which contributes to its aromatic properties, and a carbamate functional group, indicating its potential as a derivative of carbamic acid. The presence of the amino and imino groups suggests that this compound may exhibit basic properties and could participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its Z configuration indicates a specific geometric arrangement around the double bond, which can influence its reactivity and interactions with other molecules. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Additionally, its solubility and stability in different solvents can vary, affecting its practical use in laboratory and industrial settings. Overall, benzyl [(2Z)-2-amino-2-iminoethyl]carbamate is a versatile compound with interesting chemical properties worthy of further exploration.
Formula:C10H13N3O2
InChI:InChI=1/C10H13N3O2/c11-9(12)6-13-10(14)15-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,11,12)(H,13,14)
SMILES:c1ccc(cc1)COC(=NCC(=N)N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.