CAS 77394-27-5

Sesartemin

Description:

Sesartemin, with the CAS number 77394-27-5, is a naturally occurring alkaloid derived from the plant species *Sesamum indicum*, commonly known as sesame. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Sesartemin has garnered interest in pharmacological research due to its potential therapeutic properties, including anti-inflammatory and antioxidant effects. It is typically studied for its role in traditional medicine and its potential applications in modern pharmacotherapy. The substance is often analyzed using various spectroscopic techniques to elucidate its structure and confirm its purity. As with many alkaloids, sesartemin may exhibit a range of biological activities, making it a subject of interest in the fields of medicinal chemistry and natural product research. However, detailed studies on its mechanism of action and efficacy are still ongoing, highlighting the need for further investigation into its potential benefits and applications in health and medicine.

Formula: C₂₃H₂₆O₈

InChI: InChI=1S/C23H26O8/c1-24-16-5-12(6-17(25-2)22(16)27-4)20-14-9-29-21(15(14)10-28-20)13-7-18(26-3)23-19(8-13)30-11-31-23/h5-8,14-15,20-21H,9-11H2,1-4H3/t14-,15-,20+,21+/m0/s1

InChI key: InChIKey=DHWUVPPRBIJJKS-VUEDXXQZSA-N

SMILES: O(C)C=1C=C([C@@H]2[C@@]3([C@@]([C@H](OC3)C4=CC(OC)=C(OC)C(OC)=C4)(CO2)[H])[H])C=C5C1OCO5

Synonyms:

• 1H,3H-Furo[3,4-c]furan, 1,3-benzodioxole deriv.
• 4-Methoxy-6-[(1S,3aR,4S,6aR)-tetrahydro-4-(3,4,5-trimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole
• 1,3-Benzodioxole, 4-methoxy-6-[(1S,3aR,4S,6aR)-tetrahydro-4-(3,4,5-trimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]-
• 1,3-Benzodioxole, 4-methoxy-6-[tetrahydro-4-(3,4,5-trimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]-, [1S-(1α,3aα,4α,6aα)]-
• Sesartemin

Sesartemin

CAS: 77394-27-5

Sesartemin is a natural product of Rhaphidophora, Araceae.

Formula: C₂₃H₂₆O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 430.45

Ref: TM-TN5002

Sesartemin

CAS: 77394-27-5

Formula: C₂₃H₂₆O₈

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 430.453

Ref: BP-SBP02590

Sesartemin

CAS: 77394-27-5

Sesartemin is a synthetic compound, which is a laboratory-engineered product developed to target specific biological pathways. It is derived from advanced chemical synthesis techniques designed to interact with cellular mechanisms at the molecular level.

Formula: C₂₃H₂₆O₈

Purity: Min. 95%

Molecular weight: 430.4 g/mol

Ref: 3D-CDA39427