CymitQuimica logo

CAS 774-05-0

:

ethyl 2-oxo-1-cyclooctanecarboxylate

Description:
Ethyl 2-oxo-1-cyclooctanecarboxylate, with the CAS number 774-05-0, is an organic compound characterized by its ester functional group and a cyclooctane ring structure. This compound features a ketone group adjacent to the carboxylate, contributing to its reactivity and potential applications in organic synthesis. Ethyl 2-oxo-1-cyclooctanecarboxylate is typically a colorless to pale yellow liquid, exhibiting a pleasant odor. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic cycloalkane structure. The compound is of interest in various chemical reactions, including esterification and condensation reactions, making it useful in the synthesis of more complex organic molecules. Additionally, its unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c1-2-13-10(12)8-6-4-3-5-7-9(8)11/h8H,2-7H2,1H3
InChI key:MKRBAWHVHOVBOQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CCCCCC1=O
Found 5 products.