CymitQuimica logo

CAS 774-20-9

:

7-Fluoro-3,4-dihydro-1-benzoxepin-5(2H)-one

Description:
7-Fluoro-3,4-dihydro-1-benzoxepin-5(2H)-one, with the CAS number 774-20-9, is a chemical compound characterized by its unique bicyclic structure that includes a benzene ring fused to a heterocyclic oxepin moiety. This compound features a fluorine atom at the 7-position, which can influence its reactivity and biological activity. The presence of the carbonyl group (keto) at the 5-position contributes to its potential as a reactive intermediate in various chemical reactions. The dihydro configuration indicates that the compound has two hydrogen atoms added to the oxepin ring, which can affect its stability and solubility. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its synthesis, reactivity, and biological activity. Overall, 7-Fluoro-3,4-dihydro-1-benzoxepin-5(2H)-one represents a valuable structure for research in organic and medicinal chemistry.
Formula:C10H9FO2
InChI:InChI=1S/C10H9FO2/c11-7-3-4-10-8(6-7)9(12)2-1-5-13-10/h3-4,6H,1-2,5H2
InChI key:InChIKey=CIPGQCNTJQBNLR-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(F)C2)OCCC1
Synonyms:
  • 1-Benzoxepin-5(2H)-one, 7-fluoro-3,4-dihydro-
  • 7-Fluoro-3,4-dihydro-1-benzoxepin-5(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.