
CAS 774-44-7
:4-Methyl-2-phenyl-1,3-dioxane
Description:
4-Methyl-2-phenyl-1,3-dioxane is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound has a molecular formula that reflects the presence of both methyl and phenyl substituents, contributing to its unique chemical properties. It typically appears as a colorless to pale yellow liquid with a pleasant odor. The presence of the dioxane ring imparts certain stability and solubility characteristics, making it soluble in organic solvents while being less soluble in water. 4-Methyl-2-phenyl-1,3-dioxane is often utilized in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Its reactivity can be influenced by the substituents on the ring, allowing for diverse chemical transformations. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest in both industrial applications and research settings due to its structural features and reactivity.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-9-7-8-12-11(13-9)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3
InChI key:InChIKey=NJDSRMVYAFOBIZ-UHFFFAOYSA-N
SMILES:CC1OC(OCC1)C2=CC=CC=C2
Synonyms:- m-Dioxane, 4-methyl-2-phenyl-
- 2-Phenyl-4-methyl-1,3-dioxane
- 1,3-Dioxane, 4-methyl-2-phenyl-
- 4-Methyl-2-phenyl-m-dioxane
- 4-Methyl-2-phenyl-1,3-dioxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dioxane, 4-methyl-2-phenyl-
CAS:1,3-Dioxane, 4-methyl-2-phenyl- is a bioactive chemical.Formula:C11H14O2Color and Shape:SolidMolecular weight:178.23
