CAS 774-53-8

5-Bromo-2,3'-bipyridine

Description:

5-Bromo-2,3'-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 5-position of one of the pyridine rings introduces notable properties, including increased reactivity and potential for substitution reactions. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular formula is C10H8BrN2, and it has a relatively low molecular weight. 5-Bromo-2,3'-bipyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a ligand in coordination chemistry. Additionally, it can participate in various chemical reactions, including cross-coupling reactions, making it valuable in the synthesis of more complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₇BrN₂

InChI: InChI=1/C10H7BrN2/c11-9-3-4-10(13-7-9)8-2-1-5-12-6-8/h1-7H

SMILES: c1cc(cnc1)c1ccc(cn1)Br

5-Bromo-2,3'-bipyridine

CAS: 774-53-8

Formula: C₁₀H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.0800

Ref: IN-DA003MGB

5-Bromo-2,3'-bipyridine

CAS: 774-53-8

5-Bromo-2,3'-bipyridine

Purity: 99%

Molecular weight: 235.08g/mol

Ref: 54-OR310198

5-Bromo-[2,3′]bipyridinyl

CAS: 774-53-8

Formula: C₁₀H₇BrN₂

Purity: 98%

Molecular weight: 235.084

Ref: 10-F200919

5-Bromo-[2,3']bipyridinyl

CAS: 774-53-8

Versatile small molecule scaffold

Formula: C₁₀H₇BrN₂

Purity: Min. 95%

Molecular weight: 235.09 g/mol

Ref: 3D-AAA77453