CAS 774-81-2
:3-Bromo-4-methoxyphenylaceticacid
Description:
3-Bromo-4-methoxyphenylacetic acid, with the CAS number 774-81-2, is an organic compound characterized by its aromatic structure and functional groups. It features a bromine atom and a methoxy group (-OCH3) attached to a phenyl ring, along with a carboxylic acid (-COOH) group. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water may vary. The presence of the bromine atom can influence its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The methoxy group can enhance the compound's lipophilicity, affecting its biological activity and interaction with other molecules. Additionally, the carboxylic acid group contributes to its acidity and potential for forming salts or esters. Overall, 3-Bromo-4-methoxyphenylacetic acid is a versatile compound with applications in medicinal chemistry and research.
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
SMILES:COc1ccc(cc1Br)CC(=O)O
Synonyms:- 3-Bromo-4-methoxyphenylacetic acid
- Benzeneacetic acid,3-
- bromo-4-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-4-methoxyphenylacetic Acid
CAS:Formula:C9H9BrO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:245.072-(3-bromo-4-methoxyphenyl)acetic acid
CAS:Formula:C9H9BrO3Purity:98%Color and Shape:SolidMolecular weight:245.07003-Bromo-4-methoxyphenylacetic acid
CAS:3-Bromo-4-methoxyphenylacetic acidFormula:C9H9BrO3Purity:98%Color and Shape: off white solidMolecular weight:245.07g/mol3-Bromo-4-methoxyphenylacetic acid
CAS:<p>3-Bromo-4-methoxyphenylacetic acid is a benzyl ester of hydroxybenzoic acid. It is used as a synthetic precursor for the synthesis of curare and related compounds. 3-Bromo-4-methoxyphenylacetic acid was first synthesized in 1869 by German chemist Wilhelm Koenigs and has been widely used as a synthetic intermediate in organic chemistry. This compound can be prepared from bromobenzene, methoxybenzene, and acetic acid in the presence of dimethyl ether or nitrite. 3-Bromo-4-methoxyphenylacetic acid is also used to produce nitromethane, an alkylating agent that reacts with amines, alcohols, thiols, and sulfides to form N-substituted nitro compounds.</p>Formula:C9H9BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:245.07 g/mol3-Bromo-4-methoxyphenylacetic acid
CAS:Formula:C9H9BrO3Purity:97%Color and Shape:SolidMolecular weight:245.072




