CAS 774-94-7
:4-(pentafluoro-lambda~6~-sulfanyl)phenol
Description:
4-(Pentafluoro-lambda^6-sulfanyl)phenol, with the CAS number 774-94-7, is a chemical compound characterized by the presence of a phenolic group substituted with a pentafluorosulfanyl group. This compound features a sulfur atom bonded to five fluorine atoms, which imparts unique properties such as high electronegativity and reactivity. The presence of the pentafluorosulfanyl group enhances the compound's lipophilicity and can influence its solubility in various solvents. Additionally, the fluorinated moiety contributes to the compound's thermal stability and resistance to oxidation. The phenolic hydroxyl group can participate in hydrogen bonding, affecting its interactions in biological systems and materials. This compound is of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in developing fluorinated pharmaceuticals and agrochemicals. However, handling and usage require caution due to the toxicity associated with fluorinated compounds and the environmental implications of fluorine chemistry.
Formula:C6H5F5OS
InChI:InChI=1/C6H5F5OS/c7-13(8,9,10,11)6-3-1-5(12)2-4-6/h1-4,12H
SMILES:c1cc(ccc1O)S(F)(F)(F)(F)F
Synonyms:- 4-(Pentafluoro-lambda6-sulfanyl)phenol
- 4-(Pentafluorosulfanyl)phenol
- 4-(Pentafluorosulfur)phenol
- 4-(Pentafluorothio)phenol
- 4-Hydroxyphenylsulphur pentafluoride
- 4-Hydroxyphenylsulfur pentafluoride
- Qr Dsfffff
- Sulfur, pentafluoro(4-hydroxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Pentafluorothio)phenol, 97%
CAS:Synthesis of hexylamides using fluorine derivatives as intermediate active esters. Various non-metallic derivatives of pentafluorothiophenol, containing sulfur bonded to boron, carbon, silicon, germanium, phosphorus, arsenic, antimony, sulfur, and chlorine, can be prepared. This Thermo Scientific ChFormula:C6H5F5OSPurity:97%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:220.164-Hydroxyphenylsulfur pentafluoride
CAS:Formula:C6H5F5OSPurity:97%Color and Shape:SolidMolecular weight:220.16034-Hydroxyphenylsulphur pentafluoride
CAS:4-Hydroxyphenylsulphur pentafluorideFormula:C6H5F5OSPurity:97%Color and Shape: off white to faint brown crystalline solidMolecular weight:220.16g/mol4-(Pentafluorosulfur)phenol
CAS:Formula:C6H5F5OSPurity:95.0%Color and Shape:SolidMolecular weight:220.164-(Pentafluorothio)phenol
CAS:(Oc-6-21)-Pentafluoro(4-hydroxyphenyl)-sulfur is a muconic acid ester that can be synthesized by the oxidation of (OC-6-21) with lead tetraacetate and hydrogen peroxide. This reaction produces a mixture of products, including sulfuric acid, aliphatic peroxides, succinic anhydride, nitriles and esters. The yields from this reaction are low.
Formula:C6H5F5OSPurity:Min. 95%Color and Shape:PowderMolecular weight:220.16 g/mol




