CAS 7740-04-7

2-formyl-6-methoxyphenyl 4-methylbenzenesulfonate

Description:

The chemical substance known as "2-formyl-6-methoxyphenyl 4-methylbenzenesulfonate" is characterized by its complex structure, which includes a formyl group, a methoxy group, and a sulfonate moiety attached to a phenyl ring. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its molecular structure suggests it possesses both polar and non-polar characteristics, which can influence its solubility in different solvents. The presence of the sulfonate group indicates potential for ionic interactions, making it useful in applications requiring solubility in aqueous environments. Additionally, the methoxy group can enhance the compound's stability and reactivity. The CAS number 7740-04-7 is associated with a different compound, specifically "Nickel," which is a transition metal known for its catalytic properties and use in alloys. Therefore, it is essential to verify the correct CAS number when researching specific chemical substances to ensure accurate information.

Formula: C₁₅H₁₄O₅S

InChI: InChI=1/C15H14O5S/c1-11-6-8-13(9-7-11)21(17,18)20-15-12(10-16)4-3-5-14(15)19-2/h3-10H,1-2H3

SMILES: Cc1ccc(cc1)S(=O)(=O)Oc1c(cccc1OC)C=O

Synonyms:

• m-Anisaldehyde, 2-hydroxy-, p-toluenesulfonate
• Toluene-4-sulfonic acid, 2-formyl-6-methoxyphenyl ester