CymitQuimica logo

CAS 7741-81-3

:

2-methylhexahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione

Description:
The chemical substance known as 2-methylhexahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione, with the CAS number 7741-81-3, is a bicyclic compound that features a unique structure combining an isoindole framework with an epoxy group. This compound is characterized by its relatively complex ring system, which contributes to its chemical reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the epoxy group suggests that it can participate in various chemical reactions, including ring-opening and nucleophilic attacks, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the methyl group on the hexahydro structure can influence its steric and electronic properties, affecting its reactivity and interactions with other chemical species. Overall, this compound is of interest in fields such as medicinal chemistry and materials science due to its structural features and potential utility in synthetic pathways.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-10-8(11)6-4-2-3-5(13-4)7(6)9(10)12/h4-7H,2-3H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.