
CAS 77414-52-9
:4-(2-Naphthalenyl)-1,2,3-thiadiazole
Description:
4-(2-Naphthalenyl)-1,2,3-thiadiazole is an organic compound characterized by its thiadiazole ring fused with a naphthalene moiety. This compound features a five-membered heterocyclic structure containing two nitrogen atoms and one sulfur atom, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and may display moderate solubility in organic solvents, depending on the specific conditions. The presence of the naphthalene group imparts aromatic characteristics, which can influence its reactivity and stability. Thiadiazoles are known for their diverse biological activities, making this compound of interest in medicinal chemistry and material science. Its potential applications may include use as a fluorescent probe, in organic electronics, or as a precursor in the synthesis of other complex molecules. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H8N2S
InChI:InChI=1S/C12H8N2S/c1-2-4-10-7-11(6-5-9(10)3-1)12-8-15-14-13-12/h1-8H
InChI key:InChIKey=PNTNYAROJBIZDO-UHFFFAOYSA-N
SMILES:C1(=CC2=C(C=C1)C=CC=C2)C3=CSN=N3
Synonyms:- 1,2,3-Thiadiazole, 4-(2-naphthalenyl)-
- 1,2,3-Thiadiazole, 4-(2-naphthyl)-
- 4-(2-Naphthalenyl)-1,2,3-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.