CymitQuimica logo

CAS 774163-31-4

:

7-fluorochroman-4-amine

Description:
7-Fluorochroman-4-amine is a chemical compound characterized by its fluorinated chroman structure, which features a fluorine atom at the 7-position and an amine group at the 4-position of the chroman ring. This compound belongs to the class of heterocyclic organic compounds, specifically those containing a fused benzene and tetrahydrofuran ring system. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity, making it of interest in medicinal chemistry and drug development. The amine group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents. Additionally, the unique structural features of 7-fluorochroman-4-amine may contribute to its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways. As with many fluorinated compounds, it may exhibit distinct pharmacokinetic properties compared to its non-fluorinated counterparts, which can be advantageous in drug design.
Formula:C9H10FNO
InChI:InChI=1/C9H10FNO/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5,8H,3-4,11H2
SMILES:c1cc2C(CCOc2cc1F)N
Synonyms:
  • 2H-1-benzopyran-4-amine, 7-fluoro-3,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.