CAS 774191-08-1
:2-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]ethanamine
Description:
2-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]ethanamine, with the CAS number 774191-08-1, is a chemical compound characterized by its unique structure that includes a tetrazole ring and a sulfanyl (thioether) group. This compound features an ethanamine backbone, which contributes to its amine functionality. The presence of the tetrazole moiety imparts potential biological activity, as tetrazoles are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. The sulfanyl group enhances the compound's reactivity and may influence its solubility and interaction with biological targets. In terms of physical properties, while specific values such as melting point and solubility may vary, compounds of this nature typically exhibit moderate to high polarity due to the presence of both nitrogen and sulfur atoms. This compound may be of interest in medicinal chemistry and drug development, particularly in the design of novel therapeutics that leverage its unique structural features. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C4H9N5S
InChI:InChI=1/C4H9N5S/c1-9-4(6-7-8-9)10-3-2-5/h2-3,5H2,1H3
SMILES:Cn1c(nnn1)SCCN
Synonyms:- Ethanamine, 2-[(1-methyl-1H-tetrazol-5-yl)thio]-
- 2-[(1-Methyl-1H-tetrazol-5-yl)sulfanyl]ethanamine
- TIMTEC-BB SBB013896
- 2-[(1-METHYL-1H-TETRAZOL-5-YL)THIO]ETHANAMINE
- 2-((1-METHYL-1H-TETRAZOL-5-YL)THIO)ETHYLAMINE
- 2-(1-methyltetrazol-5-yl)sulfanylethanamine
- 2-[(1-methyl-1H-tetrazol-5-yl)thio]ethanamine(SALTDATA: HCl)
- ZERENEX E/6027356
- 2-(1-METHYL-1H-TETRAZOL-5-YLSULFANYL)-ETHYLAMINE
- AKOS LT-1067X0002
- CHEMBRDG-BB 4009282
- CBI-BB ZERO/006157
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.