CAS 774192-18-6

2-[(2-ethoxybenzyl)amino]ethanol

Description:

2-[(2-Ethoxybenzyl)amino]ethanol, identified by its CAS number 774192-18-6, is an organic compound characterized by the presence of an amino group and an ethanol moiety. This compound features a benzyl group substituted with an ethoxy group, which contributes to its hydrophobic characteristics, while the amino and hydroxyl groups enhance its solubility in polar solvents. The structure suggests potential for hydrogen bonding due to the hydroxyl and amino functionalities, which may influence its reactivity and interactions in biological systems. This compound may exhibit properties typical of amines, such as basicity, and could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique structure may also suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior. Overall, 2-[(2-ethoxybenzyl)amino]ethanol represents a versatile compound with interesting chemical properties.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-2-14-11-6-4-3-5-10(11)9-12-7-8-13/h3-6,12-13H,2,7-9H2,1H3

SMILES: CCOc1ccccc1CNCCO

Synonyms:

• Ethanol, 2-[[(2-Ethoxyphenyl)Methyl]Amino]-
• 2-[(2-Ethoxybenzyl)amino]ethanol