CymitQuimica logo

CAS 77421-85-3

:

2'-deoxy-5-fluoro-5'-O-nitrouridine

Description:
2'-Deoxy-5-fluoro-5'-O-nitrouridine is a nucleoside analog that features a modified uridine structure. This compound is characterized by the presence of a fluorine atom at the 5-position of the uracil base and a nitro group at the 5'-O position, which contributes to its unique chemical properties. The substitution of the hydroxyl group with a nitro group enhances its stability and may influence its biological activity. As a nucleoside analog, it can potentially interfere with nucleic acid synthesis and function, making it of interest in antiviral and anticancer research. The presence of the deoxy group indicates that it lacks an oxygen atom at the 2' position, distinguishing it from ribonucleosides and affecting its interaction with nucleic acid polymerases. Overall, 2'-deoxy-5-fluoro-5'-O-nitrouridine is a compound of significant interest in medicinal chemistry, particularly for its potential therapeutic applications.
Formula:C9H10FN3O7
InChI:InChI=1/C9H10FN3O7/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(20-7)3-19-13(17)18/h2,5-7,14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1
Synonyms:
  • Uridine, 2'-deoxy-5-fluoro-, 5'-nitrate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.