CAS 774225-50-2

Carbamic acid, (1-cyanobutyl)-, 1,1-dimethylethyl ester

Description:

Carbamic acid, (1-cyanobutyl)-, 1,1-dimethylethyl ester, identified by CAS number 774225-50-2, is an organic compound characterized by its carbamate functional group. This substance features a butyl chain with a cyano group, which contributes to its reactivity and potential applications in various chemical processes. The presence of the tert-butyl ester group enhances its stability and solubility in organic solvents. Typically, carbamic acid derivatives exhibit properties such as moderate polarity and the ability to participate in hydrogen bonding due to the presence of the carbamate moiety. This compound may be utilized in agricultural chemistry, particularly as a pesticide or herbicide, owing to its potential biological activity. Additionally, its structure suggests that it could be involved in synthetic pathways for more complex organic molecules. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact. Overall, the unique structural features of this compound make it of interest in both industrial and research settings.

Formula: C₁₀H₁₈N₂O₂

InChI: InChI=1S/C10H18N2O2/c1-5-6-8(7-11)12-9(13)14-10(2,3)4/h8H,5-6H2,1-4H3,(H,12,13)

InChI key: InChIKey=JAPNURWNRSWJTO-UHFFFAOYSA-N

SMILES: N(C(CCC)C#N)C(OC(C)(C)C)=O

Synonyms:

• Carbamic acid, (1-cyanobutyl)-, 1,1-dimethylethyl ester