
CAS 774234-26-3
:Methyl 4-iodo-1-piperidinecarboxylate
Description:
Methyl 4-iodo-1-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of the iodine atom at the 4-position of the piperidine ring contributes to its reactivity and potential applications in organic synthesis. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the iodine substituent can facilitate nucleophilic substitution reactions, making it a valuable building block in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of iodine, which can be hazardous. Overall, Methyl 4-iodo-1-piperidinecarboxylate is a versatile compound with significant implications in chemical research and development.
Formula:C7H12INO2
InChI:InChI=1S/C7H12INO2/c1-11-7(10)9-4-2-6(8)3-5-9/h6H,2-5H2,1H3
InChI key:InChIKey=FGRFTLDXKYXAFC-UHFFFAOYSA-N
SMILES:C(OC)(=O)N1CCC(I)CC1
Synonyms:- 1-Piperidinecarboxylic acid, 4-iodo-, methyl ester
- Methyl 4-iodo-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.