CAS 774238-92-5

Benzamide, 3-amino-4-fluoro-N-methoxy-N-methyl-

Description:

Benzamide, 3-amino-4-fluoro-N-methoxy-N-methyl- is an organic compound characterized by its benzamide structure, which features an amide functional group attached to a benzene ring. The presence of a fluorine atom at the 4-position and an amino group at the 3-position on the aromatic ring contributes to its unique chemical properties. The N-methoxy and N-methyl substituents enhance its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the presence of both hydrophilic (amine and methoxy groups) and hydrophobic (benzene ring) components. It may participate in hydrogen bonding, influencing its interactions in biological systems or chemical reactions. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. As with many substituted benzamides, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₉H₁₁FN₂O₂

InChI: InChI=1S/C9H11FN2O2/c1-12(14-2)9(13)6-3-4-7(10)8(11)5-6/h3-5H,11H2,1-2H3

InChI key: InChIKey=ZIQDHQRPZYNBOH-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C1=CC(N)=C(F)C=C1

Synonyms:

• 3-Amino-4-fluoro-N-methoxy-N-methylbenzamide
• Benzamide, 3-amino-4-fluoro-N-methoxy-N-methyl-