CAS 77425-85-5

(trimethylsilylmethyl)tri-n-butyltin

Description:

(trimethylsilylmethyl)tri-n-butyltin, with the CAS number 77425-85-5, is an organotin compound characterized by the presence of a tri-n-butyltin group attached to a trimethylsilylmethyl moiety. This compound typically exhibits a high degree of lipophilicity due to the bulky n-butyltin groups, which can influence its solubility and reactivity in organic solvents. Organotin compounds are known for their applications in various fields, including as biocides, stabilizers in PVC, and catalysts in organic synthesis. The presence of the trimethylsilyl group can enhance the compound's stability and reactivity, making it useful in specific chemical reactions. However, organotin compounds, including this one, can pose environmental and health risks, as they are toxic to aquatic life and can accumulate in biological systems. Therefore, handling and disposal must be conducted with caution, adhering to safety regulations. Overall, (trimethylsilylmethyl)tri-n-butyltin is a notable compound in organometallic chemistry with specific applications and safety considerations.

Formula: C₁₆H₃₈SiSn

InChI: InChI=1/C4H11Si.3C4H9.Sn/c1-5(2,3)4;3*1-3-4-2;/h1H2,2-4H3;3*1,3-4H2,2H3;/rC16H38SiSn/c1-7-10-13-18(14-11-8-2,15-12-9-3)16-17(4,5)6/h7-16H2,1-6H3

SMILES: CCCC[Sn](CCCC)(CCCC)C[Si](C)(C)C

Synonyms:

• Silane, trimethyl[(tributylstannyl)methyl]-
• Trimethyl[(tributylstannyl)methyl]silane

Tri-N-butyl(trimethylsilylmethyl)tin

Controlled Product

CAS: 77425-85-5

Versatile small molecule scaffold

Formula: C₁₆H₃₈SiSn

Purity: Min. 95%

Molecular weight: 377.3 g/mol

Ref: 3D-CDA42585