CAS 7743-39-7
:3,5-Bis(acetylamino)benzoic acid
Description:
3,5-Bis(acetylamino)benzoic acid, with the CAS number 7743-39-7, is an organic compound characterized by its aromatic structure and the presence of two acetylamino groups attached to a benzoic acid framework. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may vary depending on pH. The acetylamino groups contribute to its reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and dye manufacturing. The presence of both carboxylic acid and amide functional groups allows for potential hydrogen bonding and interactions with biological systems. Additionally, this compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Its melting point, boiling point, and other physical properties can be influenced by factors such as purity and environmental conditions. Overall, 3,5-Bis(acetylamino)benzoic acid is a versatile compound with significant implications in both industrial and research settings.
Formula:C11H12N2O4
InChI:InChI=1S/C11H12N2O4/c1-6(14)12-9-3-8(11(16)17)4-10(5-9)13-7(2)15/h3-5H,1-2H3,(H,12,14)(H,13,15)(H,16,17)
InChI key:InChIKey=GEDTXYBZWNEYAB-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(C(O)=O)=CC(NC(C)=O)=C1
Synonyms:- 3,5-Bis(Acetylamino)Benzoate
- 3,5-Bis(acetamido)benzoic acid
- 3,5-Diacetamidobenzoic acid
- Benzoic acid, 3,5-bis(acetylamino)-
- Benzoic acid, 3,5-diacetamido-
- Nsc 369057
- Sodium 3,5-Bis(Acetylamino)Benzoate
- 3,5-Bis(acetylamino)benzoic acid
- 3,5-Bis(acetylamino)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Diacetamidobenzoic acid
CAS:Formula:C11H12N2O4Purity:95%Color and Shape:SolidMolecular weight:236.22403,5-bis(acetylamino)benzoic acid
CAS:Formula:C11H12N2O4Purity:99%(LC-MS);RGColor and Shape:Solid, Light brown powderMolecular weight:236.2273,5-bis(acetylamino)benzoic acid
CAS:3,5-bis(acetylamino)benzoic acid is an activated form of 3,5-diamino benzoic acid. It is a biodegradable agent that has been shown to be effective against inflammation and pain. 3,5-Bis(acetylamino)benzoic acid can be used to treat inflammatory diseases such as rheumatoid arthritis (RA), colitis, and psoriasis. The drug is also used in the treatment of periodontal diseases and in dental care. 3,5-Bis(acetylamino)benzoic acid is made by electrochemical methods from glycol chitosan nanoparticles at high concentrations with a mineralization envisaged at mammalian cells wastewater treatment plants. This compound has been shown to have potential for wastewater treatment as it can bind to both amines and carboxylic acids found in wastewater.Formula:C11H12N2O4Purity:Min. 95%Molecular weight:236.23 g/mol



