CAS 77444-88-3

4,5-Dimethyl-3-(methylsulfonyl)-1-(phenylmethyl)-1H-pyrrol-2-amine

Description:

4,5-Dimethyl-3-(methylsulfonyl)-1-(phenylmethyl)-1H-pyrrol-2-amine is a chemical compound characterized by its complex structure, which includes a pyrrole ring substituted with various functional groups. The presence of two methyl groups at the 4 and 5 positions of the pyrrole ring contributes to its hydrophobic characteristics, while the methylsulfonyl group enhances its solubility in polar solvents. The phenylmethyl group attached to the nitrogen atom of the pyrrole ring introduces aromatic characteristics, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, its stability and reactivity can be influenced by factors such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action.

Formula: C₁₄H₁₈N₂O₂S

InChI: InChI=1S/C14H18N2O2S/c1-10-11(2)16(9-12-7-5-4-6-8-12)14(15)13(10)19(3,17)18/h4-8H,9,15H2,1-3H3

InChI key: InChIKey=KUGCTJKXMJGSBB-UHFFFAOYSA-N

SMILES: C(N1C(N)=C(S(C)(=O)=O)C(C)=C1C)C2=CC=CC=C2

Synonyms:

• 4,5-Dimethyl-3-(methylsulfonyl)-1-(phenylmethyl)-1H-pyrrol-2-amine
• 1-Benzyl-4,5-dimethyl-3-(methylsulfonyl)-1H-pyrrol-2-amine
• 1H-Pyrrol-2-amine, 4,5-dimethyl-3-(methylsulfonyl)-1-(phenylmethyl)-
• 1-Benzyl-3-methanesulfonyl-4,5-dimethyl-1H-pyrrol-2-amine