CAS 77446-17-4

1,3-dimethyl-5-prop-2-en-1-ylbenzene

Description:

1,3-Dimethyl-5-prop-2-en-1-ylbenzene, also known as isopropylstyrene, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a prop-2-en-1-yl group. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is relatively hydrophobic and has low solubility in water, but it is soluble in organic solvents such as ethanol and ether. The presence of the alkenyl group (prop-2-en-1-yl) contributes to its reactivity, making it useful in various chemical synthesis processes, particularly in polymerization reactions. Additionally, 1,3-dimethyl-5-prop-2-en-1-ylbenzene can undergo electrophilic aromatic substitution due to the electron-donating effects of the methyl groups, which enhance the reactivity of the benzene ring. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure.

Formula: C₁₁H₁₄

InChI: InChI=1/C11H14/c1-4-5-11-7-9(2)6-10(3)8-11/h4,6-8H,1,5H2,2-3H3

SMILES: C=CCc1cc(C)cc(C)c1

Synonyms:

• 1-Allyl-3,5-dimethylbenzene
• Benzene, 1,3-dimethyl-5-(2-propen-1-yl)-