CAS 77446-28-7

1-but-3-enyl-3,5-dimethyl-benzene

Description:

1-but-3-enyl-3,5-dimethyl-benzene, also known as a substituted styrene derivative, is characterized by its unique structure that includes a butenyl group attached to a benzene ring with two methyl substituents at the 3 and 5 positions. This compound exhibits properties typical of both alkenes and aromatic hydrocarbons, including a degree of unsaturation due to the presence of the double bond in the butenyl chain. It is likely to be a colorless to pale yellow liquid with a characteristic aromatic odor. The presence of the double bond suggests that it may participate in various chemical reactions, such as polymerization or electrophilic addition. Additionally, the methyl groups contribute to its hydrophobic nature and influence its boiling point and solubility in organic solvents. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks through inhalation or skin contact. Its applications could range from use in organic synthesis to potential roles in the production of specialty chemicals or materials.

Formula: C₁₂H₁₆

InChI: InChI=1/C12H16/c1-4-5-6-12-8-10(2)7-11(3)9-12/h4,7-9H,1,5-6H2,2-3H3

SMILES: C=CCCc1cc(C)cc(C)c1