CymitQuimica logo

CAS 77448-58-9

:

(2S)-amino(1-hydroxycyclopropyl)ethanoic acid

Description:
(2S)-amino(1-hydroxycyclopropyl)ethanoic acid, also known as a cyclopropyl amino acid, is characterized by its unique structure that includes a cyclopropyl ring and a hydroxyl group. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. The presence of the cyclopropyl moiety introduces strain and rigidity to the molecule, potentially influencing its biological activity and interactions with enzymes or receptors. The hydroxyl group contributes to its polarity, enhancing solubility in water and affecting its reactivity. This compound is of interest in medicinal chemistry and biochemistry due to its potential role as a building block in the synthesis of pharmaceuticals or as a biochemical probe. Its stereochemistry, indicated by the (2S) designation, suggests that it exists in a specific chiral form, which can significantly impact its biological properties and interactions. Overall, (2S)-amino(1-hydroxycyclopropyl)ethanoic acid represents a fascinating example of how structural features can influence the behavior of amino acids in biological systems.
Formula:C5H9NO3
InChI:InChI=1/C5H9NO3/c6-3(4(7)8)5(9)1-2-5/h3,9H,1-2,6H2,(H,7,8)/t3-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.