
CAS 77448-64-7
:Lychnopholide
Description:
Lychnopholide is a natural compound classified as a sesquiterpene lactone, primarily derived from plants in the Lychnophora genus, which are native to Brazil. This compound is known for its complex bicyclic structure, which contributes to its biological activity. Lychnopholide exhibits a range of pharmacological properties, including anti-inflammatory, analgesic, and potential anticancer effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves modulation of various signaling pathways and inhibition of specific enzymes. Additionally, lychnopholide has been studied for its effects on cellular processes, including apoptosis and cell proliferation. The compound is typically characterized by its solubility in organic solvents and relatively low solubility in water, which is common for many sesquiterpene lactones. As research continues, lychnopholide may offer insights into new therapeutic agents and contribute to the development of natural product-based pharmaceuticals.
Formula:C20H22O6
InChI:InChI=1S/C20H22O6/c1-6-10(2)18(22)25-15-9-20(5)16(21)8-13(26-20)11(3)7-14-17(15)12(4)19(23)24-14/h6-8,14-15,17H,4,9H2,1-3,5H3/b10-6-,11-7-/t14-,15+,17+,20-/m1/s1
InChI key:InChIKey=QATUWZPYBIHFFR-UVXIKMMUSA-N
SMILES:O(C(/C(=C\C)/C)=O)[C@@H]1[C@@]2([C@@](/C=C(/C)\C=3O[C@](C)(C1)C(=O)C3)(OC(=O)C2=C)[H])[H]
Synonyms:- (-)-Lychnopholide
- 2-Butenoic acid, 2-methyl-, 2,3,3a,4,5,6,7,11a-octahydro-6,10-dimethyl-3-methylene-2,7-dioxo-6,9-epoxycyclodeca[b]furan-4-yl ester, [3aR-[3aR*,4S*(Z),6R*,10Z,11aR*]]-
- Lychnopholide
- 6,9-Epoxycyclodeca[b]furan, 2-butenoic acid deriv.
- 2-Butenoic acid, 2-methyl-, (3aR,4S,6R,10Z,11aR)-2,3,3a,4,5,6,7,11a-octahydro-6,10-dimethyl-3-methylene-2,7-dioxo-6,9-epoxycyclodeca[b]furan-4-yl ester, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lychnopholide
CAS:<p>Lychnopholide is isolated from Vanillosmopsis erythropappa.</p>Formula:C20H22O6Color and Shape:SolidMolecular weight:358.39
