CAS 77449-02-6

(2S)-1-fluoro-3-phenylpropan-2-amine

Description:

(2S)-1-fluoro-3-phenylpropan-2-amine, with the CAS number 77449-02-6, is a chiral amine characterized by the presence of a fluorine atom and a phenyl group attached to a propan-2-amine backbone. This compound exhibits stereochemistry, specifically the S configuration at the second carbon, which influences its biological activity and interaction with receptors. The fluorine substituent can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The phenyl group contributes to the compound's aromatic character, potentially affecting its solubility and reactivity. As an amine, it can participate in various chemical reactions, including alkylation and acylation, and may act as a base in acid-base reactions. The compound's properties, such as boiling point, melting point, and solubility, are influenced by its molecular structure and functional groups. Overall, (2S)-1-fluoro-3-phenylpropan-2-amine is significant in research contexts, particularly in the development of pharmaceuticals and understanding structure-activity relationships in drug design.

Formula: C₉H₁₂FN

InChI: InChI=1/C9H12FN/c10-7-9(11)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2/t9-/m0/s1

SMILES: c1ccc(cc1)C[C@@H](CF)N