CAS 77449-31-1
:4-methoxy-6-[(3aR,4S,6aR)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole
Description:
4-Methoxy-6-[(3aR,4S,6aR)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole, with CAS number 77449-31-1, is a complex organic compound characterized by its multi-ring structure and the presence of multiple methoxy groups. This compound features a benzodioxole moiety, which contributes to its aromatic properties and potential biological activity. The tetrahydrofurofuran structure indicates that it may exhibit unique stereochemical properties due to the presence of chiral centers, influencing its interactions in biological systems. The methoxy substituents enhance its lipophilicity, potentially affecting its solubility and permeability in biological membranes. Such compounds are often studied for their pharmacological properties, including antioxidant and anti-inflammatory activities. The intricate arrangement of functional groups suggests that it may engage in various chemical reactions, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and therapeutic applications.
Formula:C23H26O8
InChI:InChI=1/C23H26O8/c1-24-16-5-12(6-17(25-2)22(16)27-4)20-14-9-29-21(15(14)10-28-20)13-7-18(26-3)23-19(8-13)30-11-31-23/h5-8,14-15,20-21H,9-11H2,1-4H3/t14-,15-,20+,21?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Episesartemin A
CAS:Episesartemin A is a natural product from Artemisia absinthium.Formula:C23H26O8Purity:98%Color and Shape:SolidMolecular weight:430.45Episesartemin A
CAS:<p>Episesartemin A is a naturally occurring lignan, which is a type of polyphenolic compound. It is derived from plants, specifically from the seeds of Sesamum indicum (sesame). The primary mode of action of Episesartemin A involves modulation of various cellular pathways, which may include antioxidant activity and interaction with enzyme systems that affect cell proliferation and apoptosis.</p>Formula:C23H26O8Purity:Min. 95%Molecular weight:430.4 g/mol


