CAS 774492-91-0
:3-bromothiophen-2-amine
Description:
3-Bromothiophen-2-amine is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 3-position and an amino group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is known for its potential applications in pharmaceuticals and materials science, particularly in the synthesis of biologically active molecules and as a building block in organic synthesis. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in synthetic chemistry. As with many brominated compounds, it is important to handle 3-bromothiophen-2-amine with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C4H4BrNS
InChI:InChI=1/C4H4BrNS/c5-3-1-2-7-4(3)6/h1-2H,6H2
SMILES:c1csc(c1Br)N
Synonyms:- 2-Thiophenamine, 3-Bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
