CAS 77453-01-1
:(B-mercapto-B,B-cyclopentamethylene-*propionyl1,O
Description:
The chemical substance known as (B-mercapto-B,B-cyclopentamethylene-propionyl) is characterized by its unique structure, which includes a mercapto group (-SH) and a cyclopentamethylene moiety. This compound is typically used in organic synthesis and may exhibit properties such as being a reducing agent due to the presence of the thiol group. The cyclopentamethylene structure contributes to its potential reactivity and steric properties, influencing how it interacts with other chemical species. Additionally, the propionyl group suggests that the compound may participate in acylation reactions. Its CAS number, 77453-01-1, allows for easy identification in chemical databases. The compound's solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. Overall, this substance is of interest in various fields, including medicinal chemistry and materials science, due to its functional groups and structural characteristics that can be leveraged in synthetic applications.
Formula:C53H77N13O11S2
InChI:InChI=1/C53H77N13O11S2/c1-4-77-34-19-17-33(18-20-34)26-36-46(71)62-37(25-32-13-7-5-8-14-32)48(73)65-44(31(2)3)50(75)63-38(27-41(54)67)47(72)64-39(30-78-79-53(28-43(69)60-36)21-9-6-10-22-53)51(76)66-24-12-16-40(66)49(74)61-35(15-11-23-58-52(56)57)45(70)59-29-42(55)68/h5,7-8,13-14,17-20,31,35-40,44H,4,6,9-12,15-16,21-30H2,1-3H3,(H2,54,67)(H2,55,68)(H,59,70)(H,60,69)(H,61,74)(H,62,71)(H,63,75)(H,64,72)(H,65,73)(H4,56,57,58)/t35?,36-,37+,38-,39+,40-,44-/m0/s1
Synonyms:- Sk&F 100398
- 1-(beta-Mercapto-beta,beta-cyclopentamethylenepropionic acid)-2-(O-ethyl-tyr)-4-val-arginine vasopressin
- Argipressin, beta-mercapto-beta,beta-cyclopentamethylenepropionic acid(1)-O-ethyltyrosyl(2)-valine(4)-
- Sk&F 101498
- Skf 100398
- Skf 101498
- d(CH2)5(D-Tyr(Et)2)vavp
- d(CH2)5(Tyr(Et)2)vavp
- d(CH2)5Tyr(Et)Vavp
- d(CH2)5Tyr(Et)Vdavp
- Vasopressin, 1-(1-mercaptocyclohexaneacetic acid)-2-(O-ethyl-L-tyrosine)-4-L-valine-8-L-arginine-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
[β-Mercapto-β,β-cyclopentamethylenepropionyl1, O-Et-Tyr2, Val4, Arg8]-Vasopressin
CAS:Formula:C53H75N13O11S2Molecular weight:1134.37[β-Mercapto-β,β-cyclopentamethylenepropionyl1, o-Et-Tyr2, Val4, Arg8]-vasopressin
CAS:Vasopressin is a peptide hormone that regulates water and electrolyte balance in the body. It is secreted by the posterior pituitary gland, where it acts on blood vessels to constrict them and raise blood pressure. Vasopressin also stimulates the release of sodium from the kidneys, which increases water retention in the body. This drug is used to treat certain types of cirrhosis, including those caused by alcoholism or viral infection. It is also used for other conditions such as congestive heart failure and high blood pressure. Vasopressin has potent antagonist effects on chloride channels, which are involved in regulating water permeability across membranes. These effects may be due to its ability to increase intracellular chloride concentrations and block chloride ion channel activity.Formula:C53H77N13O11S2Purity:Min. 95%Molecular weight:1,136.4 g/mol

