
CAS 774530-46-0
:1-(Dimethylamino)cyclopropaneethanol
Description:
1-(Dimethylamino)cyclopropaneethanol is an organic compound characterized by its unique structure, which includes a cyclopropane ring and a dimethylamino group. This compound typically exhibits properties associated with both amines and alcohols, such as the ability to form hydrogen bonds due to the hydroxyl (-OH) group, which can influence its solubility in polar solvents like water. The presence of the dimethylamino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the cyclopropane moiety can impart strain, affecting the compound's stability and reactivity. This substance may be of interest in medicinal chemistry and organic synthesis due to its potential biological activity and utility as a building block in the development of pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c1-8(2)7(3-4-7)5-6-9/h9H,3-6H2,1-2H3
InChI key:InChIKey=MEFSDRUOEADQKM-UHFFFAOYSA-N
SMILES:C(CO)C1(N(C)C)CC1
Synonyms:- 2-[1-(Dimethylamino)cyclopropyl]ethan-1-ol
- 1-(Dimethylamino)cyclopropaneethanol
- 2-(1-(Dimethylamino)cyclopropyl)ethanol
- Cyclopropaneethanol, 1-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.