CAS 774537-62-1

6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride (1:1)

Description:

6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride is a chemical compound characterized by its unique structure, which includes a bromine atom and an amine functional group attached to an isochromen backbone. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry and pharmacology. The presence of the bromine substituent can influence its biological activity, potentially enhancing its interaction with biological targets. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of targeting specific receptors or enzymes. Its molecular structure suggests it may participate in hydrogen bonding due to the amine group, which can affect its reactivity and interaction with other molecules. As with many chemical substances, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.

Formula: C₉H₁₁BrClNO

InChI: InChI=1/C9H10BrNO.ClH/c10-7-2-1-6-4-12-5-9(11)8(6)3-7;/h1-3,9H,4-5,11H2;1H