
CAS 774544-66-0
:N-(4-Fluorophenyl)thiazol-2-amine
Description:
N-(4-Fluorophenyl)thiazol-2-amine is an organic compound characterized by its thiazole and aniline functional groups. The thiazole ring, a five-membered heterocycle containing sulfur and nitrogen, contributes to its unique chemical properties, including potential biological activity. The presence of the 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. The fluorine atom can also enhance metabolic stability and alter the electronic properties of the molecule, making it a candidate for further investigation in drug design. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, N-(4-Fluorophenyl)thiazol-2-amine represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C9H7FN2S
InChI:InChI=1S/C9H7FN2S/c10-7-1-3-8(4-2-7)12-9-11-5-6-13-9/h1-6H,(H,11,12)
InChI key:InChIKey=ARCKJBKYXUAEIQ-UHFFFAOYSA-N
SMILES:N(C1=CC=C(F)C=C1)C2=NC=CS2
Synonyms:- 2-Thiazolamine, N-(4-fluorophenyl)-
- N-(4-Fluorophenyl)thiazol-2-ylamine
- N-(4-Fluorophenyl)-2-thiazolamine
- N-(4-Fluorophenyl)thiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.