CymitQuimica logo

CAS 774554-01-7

:

Tetrahydro-N-[(5-methyl-2-thienyl)methyl]-2-furanmethanamine

Description:
Tetrahydro-N-[(5-methyl-2-thienyl)methyl]-2-furanmethanamine, identified by its CAS number 774554-01-7, is a chemical compound characterized by its unique structural features, which include a tetrahydrofuran ring and a thienyl group. This compound is part of a class of amines, which are organic compounds derived from ammonia by the replacement of one or more hydrogen atoms with organic groups. The presence of the furan and thienyl moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their biological activity and ability to interact with various biological targets. The compound's molecular structure may influence its solubility, stability, and reactivity, making it of interest for further research in synthetic organic chemistry and drug design. Additionally, its specific stereochemistry and functional groups can affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME), which are critical for evaluating its potential therapeutic uses.
Formula:C11H17NOS
InChI:InChI=1S/C11H17NOS/c1-9-4-5-11(14-9)8-12-7-10-3-2-6-13-10/h4-5,10,12H,2-3,6-8H2,1H3
InChI key:InChIKey=IKLMJLBUXXIXOX-UHFFFAOYSA-N
SMILES:C(NCC1CCCO1)C=2SC(C)=CC2
Synonyms:
  • 2-Furanmethanamine, tetrahydro-N-[(5-methyl-2-thienyl)methyl]-
  • Tetrahydro-N-[(5-methyl-2-thienyl)methyl]-2-furanmethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.