CAS 774556-23-9

2-{[4-(methylsulfanyl)benzyl]amino}ethanol

Description:

2-{[4-(Methylsulfanyl)benzyl]amino}ethanol, identified by its CAS number 774556-23-9, is an organic compound characterized by the presence of an amino group and an alcohol functional group. This compound features a benzyl moiety substituted with a methylsulfanyl group, which contributes to its unique chemical properties. The amino group allows for potential interactions such as hydrogen bonding, making it soluble in polar solvents. The methylsulfanyl group can influence the compound's reactivity and stability, potentially affecting its biological activity. The presence of both the amino and hydroxyl groups suggests that this compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the structural arrangement indicates that it may exhibit chirality, leading to different stereoisomers with distinct properties. Overall, 2-{[4-(methylsulfanyl)benzyl]amino}ethanol is a versatile compound with potential applications in pharmaceuticals and organic synthesis, owing to its functional groups and structural characteristics.

Formula: C₁₀H₁₅NOS

InChI: InChI=1/C10H15NOS/c1-13-10-4-2-9(3-5-10)8-11-6-7-12/h2-5,11-12H,6-8H2,1H3

SMILES: CSc1ccc(cc1)CNCCO

Synonyms:

• Ethanol, 2-[[[4-(Methylthio)Phenyl]Methyl]Amino]-