CAS 774556-71-7

N-[4-(methylsulfanyl)benzyl]cyclopropanamine

Description:

N-[4-(methylsulfanyl)benzyl]cyclopropanamine is an organic compound characterized by its unique structure, which includes a cyclopropanamine moiety and a benzyl group substituted with a methylsulfanyl group. The presence of the cyclopropane ring contributes to its rigidity and can influence its reactivity and interaction with biological targets. The methylsulfanyl group introduces a sulfur atom into the structure, which can enhance the compound's lipophilicity and potentially affect its pharmacokinetic properties. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may play a role in its binding affinity to various receptors or enzymes. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₁₁H₁₅NS

InChI: InChI=1/C11H15NS/c1-13-11-6-2-9(3-7-11)8-12-10-4-5-10/h2-3,6-7,10,12H,4-5,8H2,1H3

SMILES: CSc1ccc(cc1)CNC1CC1

Synonyms:

• benzenemethanamine, N-cyclopropyl-4-(methylthio)-